C26H29N3O2 — CID 9372201
2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(2,6-diethylphenyl)acetamide (PubChem CID 9372201) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 9372201 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CO/N=C(/N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O2/c1-3-19-16-11-17-20(4-2)25(19)28-23(30)18-31-29-26(27)24(21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-17,24H,3-4,18H2,1-2H3,(H2,27,29)(H,28,30) |
| InChIKey | BDJZNRAMFUCETI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|