C16H12Cl2NO3- — CID 78468136
2-(2,4-dichloroanilino)-4-oxo-4-phenylbutanoate (PubChem CID 78468136) has the molecular formula C16H12Cl2NO3- and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-4-oxo-4-phenylbutanoate.
| Compound Name | 2-(2,4-dichloroanilino)-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 78468136 |
| Molecular Formula | C16H12Cl2NO3- |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-(2,4-dichloroanilino)-4-oxo-4-phenylbutanoate |
| SMILES | O=C(CC(Nc1ccc(Cl)cc1Cl)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2NO3/c17-11-6-7-13(12(18)8-11)19-14(16(21)22)9-15(20)10-4-2-1-3-5-10/h1-8,14,19H,9H2,(H,21,22)/p-1 |
| InChIKey | ROXPXIRBZRKPJV-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |