C18H19NO3 — CID 748199
(2S)-2-(2,5-dimethylanilino)-4-oxo-4-phenylbutanoic acid (PubChem CID 748199) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylanilino)-4-oxo-4-phenylbutanoic acid.
| Compound Name | (2S)-2-(2,5-dimethylanilino)-4-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 748199 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S)-2-(2,5-dimethylanilino)-4-oxo-4-phenylbutanoic acid |
| SMILES | Cc1ccc(C)c(N[C@@H](CC(=O)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H19NO3/c1-12-8-9-13(2)15(10-12)19-16(18(21)22)11-17(20)14-6-4-3-5-7-14/h3-10,16,19H,11H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | URGWRNBCRBUWRI-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |