C22H24N2O3 — CID 143057568
(4E)-2-(2,5-dimethylanilino)-4-(2-oxo-1-phenylpyrrolidin-3-ylidene)butanoic acid (PubChem CID 143057568) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (4E)-2-(2,5-dimethylanilino)-4-(2-oxo-1-phenylpyrrolidin-3-ylidene)butanoic acid.
| Compound Name | (4E)-2-(2,5-dimethylanilino)-4-(2-oxo-1-phenylpyrrolidin-3-ylidene)butanoic acid |
|---|---|
| PubChem CID | 143057568 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4E)-2-(2,5-dimethylanilino)-4-(2-oxo-1-phenylpyrrolidin-3-ylidene)butanoic acid |
| SMILES | Cc1ccc(C)c(NC(C/C=C2\CCN(c3ccccc3)C2=O)C(=O)O)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-15-8-9-16(2)20(14-15)23-19(22(26)27)11-10-17-12-13-24(21(17)25)18-6-4-3-5-7-18/h3-10,14,19,23H,11-13H2,1-2H3,(H,26,27)/b17-10+ |
| InChIKey | HSTIWCFHNXZGAY-LICLKQGHSA-N |
| XLogP | 3.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|