C18H18ClNO3S — CID 7847856
[2-(cyclopentylamino)-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate (PubChem CID 7847856) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7847856 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(Cl)cc2)s1)NC1CCCC1 |
| InChI | InChI=1S/C18H18ClNO3S/c19-13-7-5-12(6-8-13)15-9-10-16(24-15)18(22)23-11-17(21)20-14-3-1-2-4-14/h5-10,14H,1-4,11H2,(H,20,21) |
| InChIKey | RSLKZRVQJPSVGZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |