C17H14N2OS — CID 785022
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 785022) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 785022 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C17H14N2OS/c1-12-18-16(11-21-12)13-7-9-15(10-8-13)19-17(20)14-5-3-2-4-6-14/h2-11H,1H3,(H,19,20) |
| InChIKey | JNGXZFTYKGXDPW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |