C15H14ClN3O5 — CID 7851956
[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 7851956) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 7851956 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | C[C@@](C#N)(NC(=O)COC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C15H14ClN3O5/c1-15(8-17,9-2-3-9)18-13(20)7-24-14(21)11-5-4-10(16)6-12(11)19(22)23/h4-6,9H,2-3,7H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | YADUKTUHTSYVQV-HNNXBMFYSA-N |
| XLogP | 2.21 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|