C25H24N3O5+ — CID 78577798
17-hydroxy-2-(2-methoxyphenyl)-7-(3-methoxypropyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione (PubChem CID 78577798) has the molecular formula C25H24N3O5+ and a molecular weight of 446.48 g/mol. Its IUPAC name is 17-hydroxy-2-(2-methoxyphenyl)-7-(3-methoxypropyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione.
| Compound Name | 17-hydroxy-2-(2-methoxyphenyl)-7-(3-methoxypropyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
|---|---|
| PubChem CID | 78577798 |
| Molecular Formula | C25H24N3O5+ |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 17-hydroxy-2-(2-methoxyphenyl)-7-(3-methoxypropyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
| SMILES | COCCCn1c2c(c(=O)[nH]c1=O)C(c1ccccc1OC)C1=C(O)c3ccccc3C1=[NH+]2 |
| InChI | InChI=1S/C25H23N3O5/c1-32-13-7-12-28-23-20(24(30)27-25(28)31)18(16-10-5-6-11-17(16)33-2)19-21(26-23)14-8-3-4-9-15(14)22(19)29/h3-6,8-11,18,29H,7,12-13H2,1-2H3,(H,27,30,31)/p+1 |
| InChIKey | IVRULWMZXJSQAP-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|