C22H15Cl2NO2 — CID 7858967
2-(2,4-dichlorophenoxy)-1-(2-phenyl-1H-indol-3-yl)ethanone (PubChem CID 7858967) has the molecular formula C22H15Cl2NO2 and a molecular weight of 396.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-(2-phenyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-(2-phenyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 7858967 |
| Molecular Formula | C22H15Cl2NO2 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-(2-phenyl-1H-indol-3-yl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H15Cl2NO2/c23-15-10-11-20(17(24)12-15)27-13-19(26)21-16-8-4-5-9-18(16)25-22(21)14-6-2-1-3-7-14/h1-12,25H,13H2 |
| InChIKey | SOPFZZLVCBTIPO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |