C19H22O6 — CID 7859466
dimethyl 5-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxybenzene-1,3-dicarboxylate (PubChem CID 7859466) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is dimethyl 5-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7859466 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | dimethyl 5-[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)C[C@H]2C[C@H]3CC[C@H]2C3)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H22O6/c1-23-18(21)14-7-15(19(22)24-2)9-16(8-14)25-17(20)10-13-6-11-3-4-12(13)5-11/h7-9,11-13H,3-6,10H2,1-2H3/t11-,12-,13+/m0/s1 |
| InChIKey | LNEDIQIGDNDBJW-RWMBFGLXSA-N |
| XLogP | 2.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|