C15H15N3O — CID 78608845
2-cyano-3-(7-ethyl-1H-indol-3-yl)-N-methylprop-2-enamide (PubChem CID 78608845) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-cyano-3-(7-ethyl-1H-indol-3-yl)-N-methylprop-2-enamide.
| Compound Name | 2-cyano-3-(7-ethyl-1H-indol-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 78608845 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-cyano-3-(7-ethyl-1H-indol-3-yl)-N-methylprop-2-enamide |
| SMILES | CCc1cccc2c(C=C(C#N)C(=O)NC)c[nH]c12 |
| InChI | InChI=1S/C15H15N3O/c1-3-10-5-4-6-13-12(9-18-14(10)13)7-11(8-16)15(19)17-2/h4-7,9,18H,3H2,1-2H3,(H,17,19) |
| InChIKey | LTLXEEFHXANNTJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|