C28H27N3O — CID 167835780
(E)-3-(7-ethyl-1H-indol-3-yl)-2-[1-(4-ethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile (PubChem CID 167835780) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is (E)-3-(7-ethyl-1H-indol-3-yl)-2-[1-(4-ethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(7-ethyl-1H-indol-3-yl)-2-[1-(4-ethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 167835780 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (E)-3-(7-ethyl-1H-indol-3-yl)-2-[1-(4-ethylphenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
| SMILES | CCc1ccc(-n2c(C)cc(C(=O)/C(C#N)=C/c3c[nH]c4c(CC)cccc34)c2C)cc1 |
| InChI | InChI=1S/C28H27N3O/c1-5-20-10-12-24(13-11-20)31-18(3)14-26(19(31)4)28(32)22(16-29)15-23-17-30-27-21(6-2)8-7-9-25(23)27/h7-15,17,30H,5-6H2,1-4H3/b22-15+ |
| InChIKey | QDDVJUAQQXTGSI-PXLXIMEGSA-N |
| XLogP | 6.49 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|