C14H14Cl2FNO3 — CID 7864054
[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864054) has the molecular formula C14H14Cl2FNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864054 |
| Molecular Formula | C14H14Cl2FNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@@]1(C)CC1(Cl)Cl)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H14Cl2FNO3/c1-8(21-12(20)13(2)7-14(13,15)16)11(19)18-10-5-3-9(17)4-6-10/h3-6,8H,7H2,1-2H3,(H,18,19)/t8-,13-/m1/s1 |
| InChIKey | AHCXMEDLMQXKAC-AMIZOPFISA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|