C23H26FN3OS — CID 7876128
1-(1-adamantyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 7876128) has the molecular formula C23H26FN3OS and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(1-adamantyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 7876128 |
| Molecular Formula | C23H26FN3OS |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-(1-adamantyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)C23CC4CC(CC(C4)C2)C3)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3OS/c1-2-7-27-21(18-3-5-19(24)6-4-18)25-26-22(27)29-14-20(28)23-11-15-8-16(12-23)10-17(9-15)13-23/h2-6,15-17H,1,7-14H2 |
| InChIKey | LYIXOENKQGNEMT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|