C21H26N2O3S — CID 78761765
2-(dibenzylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 78761765) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-(dibenzylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(dibenzylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 78761765 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-(dibenzylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC1(NC(=O)CN(Cc2ccccc2)Cc2ccccc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(12-13-27(25,26)17-21)22-20(24)16-23(14-18-8-4-2-5-9-18)15-19-10-6-3-7-11-19/h2-11H,12-17H2,1H3,(H,22,24) |
| InChIKey | HNMNNCKTXRGKED-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |