C15H15Cl2NO3 — CID 78763925
(2-oxo-2-pyrrolidin-1-ylethyl) 3-(2,6-dichlorophenyl)prop-2-enoate (PubChem CID 78763925) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 3-(2,6-dichlorophenyl)prop-2-enoate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-(2,6-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 78763925 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-(2,6-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1c(Cl)cccc1Cl)OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-12-4-3-5-13(17)11(12)6-7-15(20)21-10-14(19)18-8-1-2-9-18/h3-7H,1-2,8-10H2 |
| InChIKey | GXDHEYRLZRGKJA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|