C17H19ClN2O4 — CID 8022379
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 8022379) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8022379 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | NC(=O)C1CCN(C(=O)COC(=O)/C=C/c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H19ClN2O4/c18-14-4-2-1-3-12(14)5-6-16(22)24-11-15(21)20-9-7-13(8-10-20)17(19)23/h1-6,13H,7-11H2,(H2,19,23)/b6-5+ |
| InChIKey | GBJANKDEYJZXEC-AATRIKPKSA-N |
| XLogP | 1.62 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|