C20H17FN4O2S — CID 78764594
3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 78764594) has the molecular formula C20H17FN4O2S and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 78764594 |
| Molecular Formula | C20H17FN4O2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[5-[2-(2-fluorophenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | Fc1ccccc1OCCSc1nnc(-c2cccnc2)n1Cc1ccco1 |
| InChI | InChI=1S/C20H17FN4O2S/c21-17-7-1-2-8-18(17)27-11-12-28-20-24-23-19(15-5-3-9-22-13-15)25(20)14-16-6-4-10-26-16/h1-10,13H,11-12,14H2 |
| InChIKey | SNWBKWHJEQYANC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|