C14H19NOS — CID 78765452
N-cyclopropyl-2-(2,5-dimethylphenyl)sulfanylpropanamide (PubChem CID 78765452) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,5-dimethylphenyl)sulfanylpropanamide.
| Compound Name | N-cyclopropyl-2-(2,5-dimethylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 78765452 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-cyclopropyl-2-(2,5-dimethylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(C)c(SC(C)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C14H19NOS/c1-9-4-5-10(2)13(8-9)17-11(3)14(16)15-12-6-7-12/h4-5,8,11-12H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | VWDRZEVYOKUMQQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |