C16H18FN5O2S — CID 7876990
2-fluoro-N'-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]benzohydrazide (PubChem CID 7876990) has the molecular formula C16H18FN5O2S and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7876990 |
| Molecular Formula | C16H18FN5O2S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-fluoro-N'-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc2n1CCCCC2)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C16H18FN5O2S/c17-12-7-4-3-6-11(12)15(24)20-19-14(23)10-25-16-21-18-13-8-2-1-5-9-22(13)16/h3-4,6-7H,1-2,5,8-10H2,(H,19,23)(H,20,24) |
| InChIKey | QHEKGRDEXBUILP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|