C18H21N5OS2 — CID 7877288
[3,5-dimethyl-4-[[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]amino]phenyl] thiocyanate (PubChem CID 7877288) has the molecular formula C18H21N5OS2 and a molecular weight of 387.53 g/mol. Its IUPAC name is [3,5-dimethyl-4-[[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]amino]phenyl] thiocyanate.
| Compound Name | [3,5-dimethyl-4-[[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 7877288 |
| Molecular Formula | C18H21N5OS2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [3,5-dimethyl-4-[[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)CSc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C18H21N5OS2/c1-12-8-14(26-11-19)9-13(2)17(12)20-16(24)10-25-18-22-21-15-6-4-3-5-7-23(15)18/h8-9H,3-7,10H2,1-2H3,(H,20,24) |
| InChIKey | GAAHXAVQIVSMKR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|