C22H23N3O2S — CID 78782747
1-[2-(benzylamino)benzimidazol-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 78782747) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[2-(benzylamino)benzimidazol-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[2-(benzylamino)benzimidazol-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 78782747 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-[2-(benzylamino)benzimidazol-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1cccs1)Cn1c(NCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C22H23N3O2S/c26-18(15-27-16-19-9-6-12-28-19)14-25-21-11-5-4-10-20(21)24-22(25)23-13-17-7-2-1-3-8-17/h1-12,18,26H,13-16H2,(H,23,24) |
| InChIKey | SDTAYCOXKOQMPZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |