C17H17BrN2O4 — CID 78783911
2-(3-bromophenoxy)-N'-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]propanehydrazide (PubChem CID 78783911) has the molecular formula C17H17BrN2O4 and a molecular weight of 393.24 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N'-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]propanehydrazide.
| Compound Name | 2-(3-bromophenoxy)-N'-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 78783911 |
| Molecular Formula | C17H17BrN2O4 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-(3-bromophenoxy)-N'-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]propanehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)C(C)Oc2cccc(Br)c2)o1 |
| InChI | InChI=1S/C17H17BrN2O4/c1-11-6-7-14(23-11)8-9-16(21)19-20-17(22)12(2)24-15-5-3-4-13(18)10-15/h3-10,12H,1-2H3,(H,19,21)(H,20,22)/b9-8+ |
| InChIKey | MWTNEJKJQKHULL-CMDGGOBGSA-N |
| XLogP | 2.98 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|