C19H15N3O4 — CID 78784337
(2E)-2-cyano-N-(2-methoxyphenyl)-5-(2-nitrophenyl)penta-2,4-dienamide (PubChem CID 78784337) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is (2E)-2-cyano-N-(2-methoxyphenyl)-5-(2-nitrophenyl)penta-2,4-dienamide.
| Compound Name | (2E)-2-cyano-N-(2-methoxyphenyl)-5-(2-nitrophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 78784337 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2E)-2-cyano-N-(2-methoxyphenyl)-5-(2-nitrophenyl)penta-2,4-dienamide |
| SMILES | COc1ccccc1NC(=O)/C(C#N)=C/C=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N3O4/c1-26-18-12-5-3-10-16(18)21-19(23)15(13-20)9-6-8-14-7-2-4-11-17(14)22(24)25/h2-12H,1H3,(H,21,23)/b8-6?,15-9+ |
| InChIKey | XNCISHPSFYTFIK-PJEGCDHPSA-N |
| XLogP | 3.71 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|