C17H13N3O4 — CID 2688555
(2E,4E)-2-cyano-N-(furan-2-ylmethyl)-5-(2-nitrophenyl)penta-2,4-dienamide (PubChem CID 2688555) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2E,4E)-2-cyano-N-(furan-2-ylmethyl)-5-(2-nitrophenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-N-(furan-2-ylmethyl)-5-(2-nitrophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 2688555 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2E,4E)-2-cyano-N-(furan-2-ylmethyl)-5-(2-nitrophenyl)penta-2,4-dienamide |
| SMILES | N#C/C(=C\C=C\c1ccccc1[N+](=O)[O-])C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H13N3O4/c18-11-14(17(21)19-12-15-8-4-10-24-15)7-3-6-13-5-1-2-9-16(13)20(22)23/h1-10H,12H2,(H,19,21)/b6-3+,14-7+ |
| InChIKey | SISONLWCMWHRMR-OPACAPKMSA-N |
| XLogP | 2.97 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|