C16H23ClN2O3S — CID 78796120
2-chloro-N-[1-[ethyl(2-hydroxyethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 78796120) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is 2-chloro-N-[1-[ethyl(2-hydroxyethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[ethyl(2-hydroxyethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 78796120 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-chloro-N-[1-[ethyl(2-hydroxyethyl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN(CCO)C(=O)C(CCSC)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O3S/c1-3-19(9-10-20)16(22)14(8-11-23-2)18-15(21)12-6-4-5-7-13(12)17/h4-7,14,20H,3,8-11H2,1-2H3,(H,18,21) |
| InChIKey | KGJXGLNAKRIWAK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |