C16H23FN2O3 — CID 78796304
N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 78796304) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 78796304 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CCN(CCO)C(=O)C(NC(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C16H23FN2O3/c1-4-19(9-10-20)16(22)14(11(2)3)18-15(21)12-5-7-13(17)8-6-12/h5-8,11,14,20H,4,9-10H2,1-3H3,(H,18,21) |
| InChIKey | LBENAMPTTBPIET-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |