C18H28N2O4 — CID 78796479
4-ethoxy-N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 78796479) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-ethoxy-N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 78796479 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-ethoxy-N-[1-[ethyl(2-hydroxyethyl)amino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)N(CC)CCO)C(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-5-20(11-12-21)18(23)16(13(3)4)19-17(22)14-7-9-15(10-8-14)24-6-2/h7-10,13,16,21H,5-6,11-12H2,1-4H3,(H,19,22) |
| InChIKey | GVQWLIXLGJLEPL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |