C12H15N3OS2 — CID 78801819
N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-ylpropanamide (PubChem CID 78801819) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-ylpropanamide.
| Compound Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 78801819 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-3-ylpropanamide |
| SMILES | CCCc1nnc(NC(=O)CCc2ccsc2)s1 |
| InChI | InChI=1S/C12H15N3OS2/c1-2-3-11-14-15-12(18-11)13-10(16)5-4-9-6-7-17-8-9/h6-8H,2-5H2,1H3,(H,13,15,16) |
| InChIKey | PKQJVFYTARWRGT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |