C19H23N5O2 — CID 78803089
N-butyl-2-[1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxyacetamide (PubChem CID 78803089) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-butyl-2-[1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxyacetamide.
| Compound Name | N-butyl-2-[1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 78803089 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-butyl-2-[1-(3,5-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxyacetamide |
| SMILES | CCCCNC(=O)COc1ncnc2c1cnn2-c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H23N5O2/c1-4-5-6-20-17(25)11-26-19-16-10-23-24(18(16)21-12-22-19)15-8-13(2)7-14(3)9-15/h7-10,12H,4-6,11H2,1-3H3,(H,20,25) |
| InChIKey | CCBHZFUQLMEYGK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|