C13H15BrClN3O2S — CID 78807171
3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 78807171) has the molecular formula C13H15BrClN3O2S and a molecular weight of 392.71 g/mol. Its IUPAC name is 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 78807171 |
| Molecular Formula | C13H15BrClN3O2S |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1SCCOc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H15BrClN3O2S/c1-19-5-4-18-9-16-17-13(18)21-7-6-20-12-3-2-10(15)8-11(12)14/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | DUWJXYJHWYRQPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|