C10H8BrClN2OS2 — CID 47114005
2-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazole (PubChem CID 47114005) has the molecular formula C10H8BrClN2OS2 and a molecular weight of 351.68 g/mol. Its IUPAC name is 2-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 47114005 |
| Molecular Formula | C10H8BrClN2OS2 |
| Molecular Weight | 351.68 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | 2-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]-1,3,4-thiadiazole |
| SMILES | Clc1ccc(OCCSc2nncs2)c(Br)c1 |
| InChI | InChI=1S/C10H8BrClN2OS2/c11-8-5-7(12)1-2-9(8)15-3-4-16-10-14-13-6-17-10/h1-2,5-6H,3-4H2 |
| InChIKey | GNPCAJYUWJSSJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|