C11H14BrClO3S — CID 79682748
3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]propane-1,2-diol (PubChem CID 79682748) has the molecular formula C11H14BrClO3S and a molecular weight of 341.65 g/mol. Its IUPAC name is 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79682748 |
| Molecular Formula | C11H14BrClO3S |
| Molecular Weight | 341.65 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 3-[2-(2-bromo-4-chlorophenoxy)ethylsulfanyl]propane-1,2-diol |
| SMILES | OCC(O)CSCCOc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C11H14BrClO3S/c12-10-5-8(13)1-2-11(10)16-3-4-17-7-9(15)6-14/h1-2,5,9,14-15H,3-4,6-7H2 |
| InChIKey | ZPNSBIKFCSCIDT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|