C13H20O3S — CID 79682193
3-[2-(3,5-dimethylphenoxy)ethylsulfanyl]propane-1,2-diol (PubChem CID 79682193) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenoxy)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(3,5-dimethylphenoxy)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79682193 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[2-(3,5-dimethylphenoxy)ethylsulfanyl]propane-1,2-diol |
| SMILES | Cc1cc(C)cc(OCCSCC(O)CO)c1 |
| InChI | InChI=1S/C13H20O3S/c1-10-5-11(2)7-13(6-10)16-3-4-17-9-12(15)8-14/h5-7,12,14-15H,3-4,8-9H2,1-2H3 |
| InChIKey | YTBYGGFKYVMNMS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|