C10H22N2O3 — CID 78807491
2-[bis(2-methoxyethyl)amino]-N,N-dimethylacetamide (PubChem CID 78807491) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 78807491 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-N,N-dimethylacetamide |
| SMILES | COCCN(CCOC)CC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O3/c1-11(2)10(13)9-12(5-7-14-3)6-8-15-4/h5-9H2,1-4H3 |
| InChIKey | GWSMXZCUDYVOIH-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |