C17H24N8OS — CID 78810182
7-methyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 78810182) has the molecular formula C17H24N8OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 7-methyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 78810182 |
| Molecular Formula | C17H24N8OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 7-methyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)c2nc3nccc(C)n3n2)n1CC(C)C |
| InChI | InChI=1S/C17H24N8OS/c1-11(2)10-24-13(21-22-17(24)27-4)6-5-8-18-15(26)14-20-16-19-9-7-12(3)25(16)23-14/h7,9,11H,5-6,8,10H2,1-4H3,(H,18,26) |
| InChIKey | CHSYTMXAYQFDCU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|