C22H30N6OS — CID 134013574
4-(3,5-dimethylpyrazol-1-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 134013574) has the molecular formula C22H30N6OS and a molecular weight of 426.59 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 134013574 |
| Molecular Formula | C22H30N6OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | CSc1nnc(CCCNC(=O)c2ccc(-n3nc(C)cc3C)cc2)n1CC(C)C |
| InChI | InChI=1S/C22H30N6OS/c1-15(2)14-27-20(24-25-22(27)30-5)7-6-12-23-21(29)18-8-10-19(11-9-18)28-17(4)13-16(3)26-28/h8-11,13,15H,6-7,12,14H2,1-5H3,(H,23,29) |
| InChIKey | UDQPSZKENRPKMI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|