C14H18FNO3S — CID 78812762
ethyl 2-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]sulfanylacetate (PubChem CID 78812762) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 2-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 78812762 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | ethyl 2-[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(=O)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C14H18FNO3S/c1-3-19-14(18)10-20-9-13(17)16(2)8-11-6-4-5-7-12(11)15/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | GIFXUDJMMIKFFN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |