C22H23N3O4 — CID 78814709
5-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-8-nitroisoquinoline (PubChem CID 78814709) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-8-nitroisoquinoline.
| Compound Name | 5-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-8-nitroisoquinoline |
|---|---|
| PubChem CID | 78814709 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-(6,7-diethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-8-nitroisoquinoline |
| SMILES | CCOc1cc2c(cc1OCC)CN(c1ccc([N+](=O)[O-])c3cnccc13)CC2 |
| InChI | InChI=1S/C22H23N3O4/c1-3-28-21-11-15-8-10-24(14-16(15)12-22(21)29-4-2)19-5-6-20(25(26)27)18-13-23-9-7-17(18)19/h5-7,9,11-13H,3-4,8,10,14H2,1-2H3 |
| InChIKey | HVLFRDKJGQHTLN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|