C20H26N2O3S — CID 78824473
2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 78824473) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 78824473 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1ccc(-n2c(C)cc(CC(=O)NC3(C)CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-14-5-7-18(8-6-14)22-15(2)11-17(16(22)3)12-19(23)21-20(4)9-10-26(24,25)13-20/h5-8,11H,9-10,12-13H2,1-4H3,(H,21,23) |
| InChIKey | KYMFHENUOPUSRG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|