(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate

C15H16O5 — CID 78824904

IUPAC(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate
SMILESCOCc1ccc(C(=O)OCc2ccccc2OC)o1
InChIInChI=1S/C15H16O5/c1-17-10-12-7-8-14(20-12)15(16)19-9-11-5-3-4-6-13(11)18-2/h3-8H,9-10H2,1-2H3
InChIKeyFTKSGZZMKJJCLM-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.79
Rot. Bonds6

About (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate

(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate (PubChem CID 78824904) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate.

Molecular Properties

Compound Name(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate
PubChem CID78824904
Molecular FormulaC15H16O5
Molecular Weight276.29 g/mol
Exact Mass276.10
IUPAC Name(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate
SMILESCOCc1ccc(C(=O)OCc2ccccc2OC)o1
InChIInChI=1S/C15H16O5/c1-17-10-12-7-8-14(20-12)15(16)19-9-11-5-3-4-6-13(11)18-2/h3-8H,9-10H2,1-2H3
InChIKeyFTKSGZZMKJJCLM-UHFFFAOYSA-N
XLogP2.79
TPSA57.90 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate?
The IUPAC name of (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate (CID 78824904) is (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate.
What is the SMILES notation for (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate?
The canonical SMILES for (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate is COCc1ccc(C(=O)OCc2ccccc2OC)o1.
What is the InChIKey of (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate?
The InChIKey is FTKSGZZMKJJCLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-17-10-12-7-8-14(20-12)15(16)19-9-11-5-3-4-6-13(11)18-2/h3-8H,9-10H2,1-2H3.
What are the key properties of (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate?
(2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate has a molecular weight of 276.29 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)methyl 5-(methoxymethyl)furan-2-carboxylate is sourced from PubChem (CID 78824904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).