C22H29N3O3S — CID 78825203
2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 78825203) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-N-(1-ethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-N-(1-ethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 78825203 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[2,3-dihydro-1,4-benzodioxin-6-yl(thiophen-2-ylmethyl)amino]-N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCN1CCC(NC(=O)CN(Cc2cccs2)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-2-24-9-7-17(8-10-24)23-22(26)16-25(15-19-4-3-13-29-19)18-5-6-20-21(14-18)28-12-11-27-20/h3-6,13-14,17H,2,7-12,15-16H2,1H3,(H,23,26) |
| InChIKey | QONRTMUKRXRFTM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|