C26H33N3O3 — CID 78826278
2-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 78826278) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-N-(1-ethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-N-(1-ethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 78826278 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCN1CCC(NC(=O)CN(C/C=C/c2ccccc2)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C26H33N3O3/c1-2-28-15-12-22(13-16-28)27-26(30)20-29(14-6-9-21-7-4-3-5-8-21)23-10-11-24-25(19-23)32-18-17-31-24/h3-11,19,22H,2,12-18,20H2,1H3,(H,27,30)/b9-6+ |
| InChIKey | BOTHZTIASNFEAM-RMKNXTFCSA-N |
| XLogP | 3.58 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|