C19H28N2O4S — CID 78832224
(1-ethylsulfonyl-4-phenylpiperidin-4-yl)-(2-methylmorpholin-4-yl)methanone (PubChem CID 78832224) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is (1-ethylsulfonyl-4-phenylpiperidin-4-yl)-(2-methylmorpholin-4-yl)methanone.
| Compound Name | (1-ethylsulfonyl-4-phenylpiperidin-4-yl)-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 78832224 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1-ethylsulfonyl-4-phenylpiperidin-4-yl)-(2-methylmorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N2CCOC(C)C2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O4S/c1-3-26(23,24)21-11-9-19(10-12-21,17-7-5-4-6-8-17)18(22)20-13-14-25-16(2)15-20/h4-8,16H,3,9-15H2,1-2H3 |
| InChIKey | UXXMQTFHBNXMGV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |