C18H13N3O2S — CID 78832475
N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]quinoline-4-carboxamide (PubChem CID 78832475) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]quinoline-4-carboxamide.
| Compound Name | N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 78832475 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]quinoline-4-carboxamide |
| SMILES | O=C(NCc1coc(-c2cccs2)n1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C18H13N3O2S/c22-17(14-7-8-19-15-5-2-1-4-13(14)15)20-10-12-11-23-18(21-12)16-6-3-9-24-16/h1-9,11H,10H2,(H,20,22) |
| InChIKey | JJAZKTPKZYJFKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |