C22H34N4O3 — CID 78839433
N-[4-[[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 78839433) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[4-[[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-[[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 78839433 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N-[4-[[1-(2-ethylpiperidin-1-yl)-1-oxopropan-2-yl]amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | CCC1CCCCN1C(=O)C(C)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H34N4O3/c1-3-20-6-4-5-11-26(20)22(28)17(2)23-18-7-9-19(10-8-18)24-21(27)16-25-12-14-29-15-13-25/h7-10,17,20,23H,3-6,11-16H2,1-2H3,(H,24,27) |
| InChIKey | HXTDNNMWEREXPR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |