C19H27N3O — CID 91643924
1-(2-ethylpiperidin-1-yl)-2-[(2-methyl-1H-indol-5-yl)amino]propan-1-one (PubChem CID 91643924) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-[(2-methyl-1H-indol-5-yl)amino]propan-1-one.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-[(2-methyl-1H-indol-5-yl)amino]propan-1-one |
|---|---|
| PubChem CID | 91643924 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-[(2-methyl-1H-indol-5-yl)amino]propan-1-one |
| SMILES | CCC1CCCCN1C(=O)C(C)Nc1ccc2[nH]c(C)cc2c1 |
| InChI | InChI=1S/C19H27N3O/c1-4-17-7-5-6-10-22(17)19(23)14(3)21-16-8-9-18-15(12-16)11-13(2)20-18/h8-9,11-12,14,17,20-21H,4-7,10H2,1-3H3 |
| InChIKey | DGNLMKKVTUNUOH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |