C25H27N3O4 — CID 78839863
methyl 1-[(E)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate (PubChem CID 78839863) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 1-[(E)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate.
| Compound Name | methyl 1-[(E)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 78839863 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | methyl 1-[(E)-2-cyano-3-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]prop-2-enoyl]-2,3-dihydroindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCN2C(=O)/C(C#N)=C/c1cc(C)n(CC2CCCO2)c1C |
| InChI | InChI=1S/C25H27N3O4/c1-16-11-20(17(2)28(16)15-22-5-4-10-32-22)13-21(14-26)24(29)27-9-8-18-12-19(25(30)31-3)6-7-23(18)27/h6-7,11-13,22H,4-5,8-10,15H2,1-3H3/b21-13+ |
| InChIKey | XWLWAQABZIMJQV-FYJGNVAPSA-N |
| XLogP | 3.57 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|