C19H19ClN2O4S — CID 78844646
methyl 4-chloro-3-[[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]amino]benzoate (PubChem CID 78844646) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 78844646 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | methyl 4-chloro-3-[[1-(thiophene-2-carbonyl)piperidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2CCCCN2C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H19ClN2O4S/c1-26-19(25)12-7-8-13(20)14(11-12)21-17(23)15-5-2-3-9-22(15)18(24)16-6-4-10-27-16/h4,6-8,10-11,15H,2-3,5,9H2,1H3,(H,21,23) |
| InChIKey | UZDZBOLJKAOPAL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |