C16H16BrN3O2S — CID 78844765
N-(5-bromo-2-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78844765) has the molecular formula C16H16BrN3O2S and a molecular weight of 394.29 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78844765 |
| Molecular Formula | C16H16BrN3O2S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H16BrN3O2S/c17-11-6-7-14(18-10-11)19-15(21)12-4-1-2-8-20(12)16(22)13-5-3-9-23-13/h3,5-7,9-10,12H,1-2,4,8H2,(H,18,19,21) |
| InChIKey | IVICXRJFNORHHV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |